VirtualTaste

Natural Compounds

The taste of a selection of natural compounds was predicted using our taste prediction models. This dataset includes compounds that were predicted to either have a sweet (S) or bitter (B) taste. All of these compounds can be found in the Supernatural II Database and can be accessed through the Supernatural ID links.

Supernatural ID	SMILES	Taste	Confidence
SN00156342	CCC[C@H](CCC)O	B	0.987999976
SN00156347	CCCCCC(=O)OCC	B	0.994000018
SN00156348	CCCCCCCC(=O)OCC	B	0.994000018
SN00156349	CCCCCCCCCCCC(=O)OCC	B	0.994000018
SN00156358	CCCCCCCC(=O)C	B	0.987999976
SN00156359	CCCCCCCCCCCC(=O)C	B	0.987999976
SN00156366	Cc1cccc2c1cccc2	B	0.959999979
SN00156367	CCCCCCCO	B	0.952000022
SN00156369	CCCCC=O	B	0.981999993
SN00156374	CCCCCCCOC(=O)C	B	0.995999992
SN00156379	C[C@@H]1CC[C@H](CC1)C	B	0.973999977
SN00156383	C[C@H](C)CC(=O)OCc1ccccc1	B	0.970000029
SN00156384	CCCCCCCCCCOC(=O)C	B	0.995999992
SN00156386	CCOC(=O)C(=O)C	B	0.977999985
SN00156389	Cc1cccc(c1C)C	B	0.953999996
SN00156390	CCCCCCCCCCCCCO	B	0.958000004
SN00156392	CCCCCCOC(=O)C	B	0.995999992
SN00156393	C[C@H]1CC[C@@H]([C@H](C1)OC(=O)c1ccccc1)[C@H](C)C	B	0.963999987
SN00156397	C[C@@H]1CCCC1=O	B	0.95599997
SN00156399	CCCCCCCCC=O	B	0.970000029
SN00156400	CCCCCCCCCO	B	0.958000004
SN00156412	CCCCCCCCCC=O	B	0.970000029
SN00156413	C[C@H](C)C(=O)c1ccccc1	B	0.966000021
SN00156419	C(CCCCCCC)OC(=O)C	B	0.995999992
SN00156420	CCCCCCCCCCCCOC(=O)C	B	0.995999992

Page 56 of 163